CAS:1466-76-8|2,6-Dimethoxybenzoic Acid
Molecular Formula:C9H10O4
Molecular Weight:182.17 g/mol
EINECS:215-985-4
Purity:98 percent
Package:100g/250g/500g/1000g/bulk package
- Pengiriman ke Seluruh Dunia
- Kualitas asuransi
- Layanan Pelanggan 24/7
perkenalan produk
2,6-Dimethoxybenzoic acid(CAS:1466-76-8) has a wide range of scientific research applications. It has been used in in vivo and in vitro studies to investigate the mechanism of action, biological activity, biochemical and physiological effects, and pharmacodynamics of various compounds.
|
|
|
| 2,6-dimethoxybenzoic acid | |
| MFCD00002437 | |
| 186 degree | |
| 314.5ºC at 760 mmHg | |
| 126.5ºC | |
| 1.214 g/cm3 | |
| 55.76 | |
| 1.40 | |
| 0.000197mmHg at 25 degree | |
| White to off-white crystalline powder | |
| 0.35 g/100 mL (25 ºC) | |
| InChI=1S/C9H10O4/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) | |
| MBIZFBDREVRUHY-UHFFFAOYSA-N |
Tag populer: cas:1466-76-8|2,6-dimethoxybenzoic acid, price, quotation, discount, in stock, for sale
